EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8F4O4S |
| Net Charge | 0 |
| Average Mass | 348.273 |
| Monoisotopic Mass | 348.00794 |
| SMILES | O=S1(=O)c2ccc(F)cc2Oc2cc(OCC(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H8F4O4S/c15-8-1-3-12-10(5-8)22-11-6-9(21-7-14(16,17)18)2-4-13(11)23(12,19)20/h1-6H,7H2 |
| InChIKey | PDIMOTRDGUQMNY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cx-157 (CHEBI:758459) has role antidepressant (CHEBI:35469) |
| cx-157 (CHEBI:758459) is a organic heterotricyclic compound (CHEBI:26979) |
| cx-157 (CHEBI:758459) is a organosulfur heterocyclic compound (CHEBI:38106) |
| cx-157 (CHEBI:758459) is a oxacycle (CHEBI:38104) |
| Synonyms | Source |
|---|---|
| CX-157 | ChEMBL |
| CX157 | ChEMBL |
| KP157 | ChEMBL |
| Tririma | ChEMBL |
| Tyrima | ChEMBL |