EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19FN4O2S |
| Net Charge | 0 |
| Average Mass | 386.452 |
| Monoisotopic Mass | 386.12128 |
| SMILES | NC(=O)Nc1cc(C#Cc2cccc(F)c2)sc1C(=O)N[C@H]1CCCNC1 |
| InChI | InChI=1S/C19H19FN4O2S/c20-13-4-1-3-12(9-13)6-7-15-10-16(24-19(21)26)17(27-15)18(25)23-14-5-2-8-22-11-14/h1,3-4,9-10,14,22H,2,5,8,11H2,(H,23,25)(H3,21,24,26)/t14-/m0/s1 |
| InChIKey | ULVAGWVTXBTFRN-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phi-101 (CHEBI:758458) has role antineoplastic agent (CHEBI:35610) |
| phi-101 (CHEBI:758458) is a aromatic amide (CHEBI:62733) |
| phi-101 (CHEBI:758458) is a thiophenes (CHEBI:26961) |
| Synonyms | Source |
|---|---|
| PHI-101 | ChEMBL |
| PHI101 | ChEMBL |