EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:758457 - h-100
| Formula | C11H11N3O3 |
| Net Charge | 0 |
| Average Mass | 233.227 |
| Monoisotopic Mass | 233.08004 |
| SMILES | N#CCNC(=O)CNc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H11N3O3/c12-5-6-13-10(15)7-14-9-3-1-8(2-4-9)11(16)17/h1-4,14H,6-7H2,(H,13,15)(H,16,17) |
| InChIKey | ILTWRLHXJMWZHP-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| h-100 (CHEBI:758457) is a amino acid amide (CHEBI:22475) |
| Synonyms | Source |
|---|---|
| H-100 | ChEMBL |
| H100 | ChEMBL |