EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15NO3S.C7H8ClN3O4S2 |
| Net Charge | 0 |
| Average Mass | 515.035 |
| Monoisotopic Mass | 514.04174 |
| SMILES | C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O.NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O |
| InChI | InChI=1S/C9H15NO3S.C7H8ClN3O4S2/c1-6(5-14)8(11)10-4-2-3-7(10)9(12)13;8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h6-7,14H,2-5H2,1H3,(H,12,13);1-2,10-11H,3H2,(H2,9,12,13)/t6-,7+;/m1./s1 |
| InChIKey | SFIUYASDNWEYDB-HHQFNNIRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| co-zidocapt (CHEBI:758455) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| Captopress | ChEMBL |
| Captopril tz | ChEMBL |
| Co-zidocapt | ChEMBL |
| Dosturel | ChEMBL |