EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29F3N8O5S |
| Net Charge | 0 |
| Average Mass | 598.608 |
| Monoisotopic Mass | 598.19337 |
| SMILES | COC(=O)Nc1cc(C(F)(F)F)c(-c2nc(N3CCOCC3)c3cc(CN4CCN(S(C)(=O)=O)CC4)cn3n2)cn1 |
| InChI | InChI=1S/C24H29F3N8O5S/c1-39-23(36)29-20-12-18(24(25,26)27)17(13-28-20)21-30-22(33-7-9-40-10-8-33)19-11-16(15-35(19)31-21)14-32-3-5-34(6-4-32)41(2,37)38/h11-13,15H,3-10,14H2,1-2H3,(H,28,29,36) |
| InChIKey | KTLQDDGRBDLKMN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| risovalisib (CHEBI:758451) has role antineoplastic agent (CHEBI:35610) |
| risovalisib (CHEBI:758451) is a pyrrolotriazine (CHEBI:88341) |
| INN | Source |
|---|---|
| risovalisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cyh 33 | ChEMBL |
| Cyh33 | ChEMBL |
| CYH-33 | ChEMBL |
| Citations |
|---|