EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N4O2 |
| Net Charge | 0 |
| Average Mass | 286.335 |
| Monoisotopic Mass | 286.14298 |
| SMILES | Cc1nnc(-c2cnc(=O)nc2=O)cc1[C@H]1C[C@@H]1C(C)C |
| InChI | InChI=1S/C15H18N4O2/c1-7(2)9-4-11(9)10-5-13(19-18-8(10)3)12-6-16-15(21)17-14(12)20/h5-7,9,11H,4H2,1-3H3,(H2,16,17,20,21)/t9-,11+/m1/s1 |
| InChIKey | WHRUIISQCORGKK-KOLCDFICSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly-3475070 (CHEBI:758448) has role antineoplastic agent (CHEBI:35610) |
| ly-3475070 (CHEBI:758448) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| Synonyms | Source |
|---|---|
| Ly 3475070 | ChEMBL |
| Ly-3475070 | ChEMBL |
| LY3475070 | ChEMBL |
| Citations |
|---|