EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18D3FN6O3 |
| Net Charge | 0 |
| Average Mass | 439.465 |
| Monoisotopic Mass | 439.18475 |
| SMILES | [2H]C([2H])([2H])NC(=O)c1cnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ncc(F)cn2)c1OC |
| InChI | InChI=1S/C22H21FN6O3/c1-24-22(31)15-11-25-18(29-21(30)12-6-7-12)8-17(15)28-16-5-3-4-14(19(16)32-2)20-26-9-13(23)10-27-20/h3-5,8-12H,6-7H2,1-2H3,(H,24,31)(H2,25,28,29,30)/i1D3 |
| InChIKey | BBRMAVGRWHNAIG-FIBGUPNXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-986202 (CHEBI:758445) has role antipsoriatic (CHEBI:50748) |
| bms-986202 (CHEBI:758445) is a aromatic carboxylic acid (CHEBI:33859) |
| bms-986202 (CHEBI:758445) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| Bms-986202 | ChEMBL |
| BMS986202 | ChEMBL |
| Citations |
|---|