EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27ClN6O |
| Net Charge | 0 |
| Average Mass | 390.919 |
| Monoisotopic Mass | 390.19349 |
| SMILES | C[C@H]1CN(C2CCN(c3nnc(N)n3)CC2)[C@@H](Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C19H27ClN6O/c1-13-11-26(17(12-27-13)10-14-2-4-15(20)5-3-14)16-6-8-25(9-7-16)19-22-18(21)23-24-19/h2-5,13,16-17H,6-12H2,1H3,(H3,21,22,23,24)/t13-,17-/m0/s1 |
| InChIKey | STWVLEKJQQRGMO-GUYCJALGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(4-((2s,5s)-5-(4-chlorobenzyl)-2-methylmorpholino)piperidin-1-yl)-1h-1,2,4-triazol-3-amine (CHEBI:758444) has role anti-inflammatory agent (CHEBI:67079) |
| 5-(4-((2s,5s)-5-(4-chlorobenzyl)-2-methylmorpholino)piperidin-1-yl)-1h-1,2,4-triazol-3-amine (CHEBI:758444) is a dialkylarylamine (CHEBI:23665) |
| 5-(4-((2s,5s)-5-(4-chlorobenzyl)-2-methylmorpholino)piperidin-1-yl)-1h-1,2,4-triazol-3-amine (CHEBI:758444) is a tertiary amino compound (CHEBI:50996) |
| Synonyms | Source |
|---|---|
| 5-(4-((2s,5s)-5-(4-chlorobenzyl)-2-methylmorpholino)piperidin-1-yl)-1h-1,2,4-triazol-3-amine | ChEMBL |
| GLP 4716 | ChEMBL |
| Glpg4716 | ChEMBL |
| OAT 889 | ChEMBL |
| OATD 01 | ChEMBL |
| OATD-01 | ChEMBL |
| Citations |
|---|