EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32F2N4O3 |
| Net Charge | 0 |
| Average Mass | 534.607 |
| Monoisotopic Mass | 534.24425 |
| SMILES | CO[C@H]1CC[C@H](n2c([C@@H]3CCCC(=O)N3c3ccc(F)c(F)c3)nc3cc(-c4c(C)noc4C)ccc32)CC1 |
| InChI | InChI=1S/C30H32F2N4O3/c1-17-29(18(2)39-34-17)19-7-14-26-25(15-19)33-30(36(26)20-8-11-22(38-3)12-9-20)27-5-4-6-28(37)35(27)21-10-13-23(31)24(32)16-21/h7,10,13-16,20,22,27H,4-6,8-9,11-12H2,1-3H3/t20-,22-,27-/m0/s1 |
| InChIKey | SKDNDJWEBPQKCS-CLHVYKLBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inobrodib (CHEBI:758440) has role antineoplastic agent (CHEBI:35610) |
| inobrodib (CHEBI:758440) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| inobrodib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ccs 1477 | ChEMBL |
| CCS-1477 | ChEMBL |
| CCS1477 | ChEMBL |
| Citations |
|---|