EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25N7O |
| Net Charge | 0 |
| Average Mass | 427.512 |
| Monoisotopic Mass | 427.21206 |
| SMILES | CN1CCN(c2cc(C(=O)Nc3cc4cc(-c5cnn(C)c5)ccc4cn3)ccn2)CC1 |
| InChI | InChI=1S/C24H25N7O/c1-29-7-9-31(10-8-29)23-13-18(5-6-25-23)24(32)28-22-12-20-11-17(3-4-19(20)14-26-22)21-15-27-30(2)16-21/h3-6,11-16H,7-10H2,1-2H3,(H,26,28,32) |
| InChIKey | BQWWOBKMDWACGC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cirtuvivint (CHEBI:758438) has role antineoplastic agent (CHEBI:35610) |
| cirtuvivint (CHEBI:758438) is a piperazines (CHEBI:26144) |
| cirtuvivint (CHEBI:758438) is a pyridines (CHEBI:26421) |
| Synonym | Source |
|---|---|
| Cirtuvivint | ChEMBL |
| Citations |
|---|