EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N3O9PS |
| Net Charge | 0 |
| Average Mass | 543.535 |
| Monoisotopic Mass | 543.14404 |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=S)(OC[C@H]1O[C@@H](n2ccc(=O)nc2=O)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H30N3O9PS/c1-13(2)32-19(28)14(3)24-35(36,34-15-8-6-5-7-9-15)31-12-16-18(27)22(4,30)20(33-16)25-11-10-17(26)23-21(25)29/h5-11,13-14,16,18,20,27,30H,12H2,1-4H3,(H,24,36)(H,23,26,29)/t14-,16+,18+,20+,22+,35?/m0/s1 |
| InChIKey | XFJMOMBVBMXWCV-ZSNLZBCWSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vx-135 (CHEBI:758437) has role antiviral agent (CHEBI:22587) |
| vx-135 (CHEBI:758437) is a pyrimidine nucleoside (CHEBI:26440) |
| Synonym | Source |
|---|---|
| Vx-135 | ChEMBL |