EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO5 |
| Net Charge | 0 |
| Average Mass | 319.357 |
| Monoisotopic Mass | 319.14197 |
| SMILES | CN1C2CC(OC(=O)C(O)(CO)c3ccccc3)CC1C1OC12 |
| InChI | InChI=1S/C17H21NO5/c1-18-12-7-11(8-13(18)15-14(12)23-15)22-16(20)17(21,9-19)10-5-3-2-4-6-10/h2-6,11-15,19,21H,7-9H2,1H3 |
| InChIKey | JEJREKXHLFEVHN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anisodine hydrobromide (CHEBI:758435) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| Anisodine hydrobromide | ChEMBL |
| J3.145.635E | ChEMBL |