EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H16D2F4N4O2 |
| Net Charge | 0 |
| Average Mass | 460.427 |
| Monoisotopic Mass | 460.14914 |
| SMILES | [H][C@]12C[C@@H](Oc3ccc(C(F)(F)F)cn3)[C@]([H])(C1)N(C(=O)c1cccc(F)c1-c1ncccn1)C2([2H])[2H] |
| InChI | InChI=1S/C23H18F4N4O2/c24-16-4-1-3-15(20(16)21-28-7-2-8-29-21)22(32)31-12-13-9-17(31)18(10-13)33-19-6-5-14(11-30-19)23(25,26)27/h1-8,11,13,17-18H,9-10,12H2/t13-,17+,18-/m1/s1/i12D2 |
| InChIKey | HUKWIAXQBOHZIX-USKNZQBOSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tebideutorexant (CHEBI:758432) has role antidepressant (CHEBI:35469) |
| tebideutorexant (CHEBI:758432) is a N-acylpiperidine (CHEBI:48591) |
| INN | Source |
|---|---|
| tebideutorexant | WHO MedNet |
| Synonym | Source |
|---|---|
| Jnj-61393215 | ChEMBL |