EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H35N7O2 |
| Net Charge | 0 |
| Average Mass | 525.657 |
| Monoisotopic Mass | 525.28522 |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C4CC4)c4ccccc34)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C30H35N7O2/c1-6-29(38)32-24-17-25(28(39-5)18-27(24)36(4)16-15-35(2)3)34-30-31-14-13-23(33-30)22-19-37(20-11-12-20)26-10-8-7-9-21(22)26/h6-10,13-14,17-20H,1,11-12,15-16H2,2-5H3,(H,32,38)(H,31,33,34) |
| InChIKey | DOEOECWDNSEFDN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aumolertinib (CHEBI:758431) has role antineoplastic agent (CHEBI:35610) |
| aumolertinib (CHEBI:758431) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Almonertinib | ChEMBL |
| Ameile | ChEMBL |
| Amerol | ChEMBL |
| Aumolertinib | ChEMBL |
| Egfr t790m inhibitor hs-10296 | ChEMBL |
| EQ-143 | ChEMBL |
| Citations |
|---|