EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O6 |
| Net Charge | 0 |
| Average Mass | 178.140 |
| Monoisotopic Mass | 178.04774 |
| SMILES | O=C(O)C1(O)C[C@H](O)[C@@H](O)CO1 |
| WURCS | WURCS=2.0/1,1,0/[Aad21h-2x_2-6]/1/ |
| InChI | InChI=1S/C6H10O6/c7-3-1-6(11,5(9)10)12-2-4(3)8/h3-4,7-8,11H,1-2H2,(H,9,10)/t3-,4-,6?/m0/s1 |
| InChIKey | SQMDJKFNRLCHMW-IUJOKSNGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-deoxy-L-threo-hex-2-ulopyranosonic acid (CHEBI:75843) is a ketoaldonic acid (CHEBI:24963) |
| 3-deoxy-L-threo-hex-2-ulopyranosonic acid (CHEBI:75843) is conjugate acid of 3-deoxy-L-threo-hex-2-ulopyranosonate (CHEBI:75552) |
| Incoming Relation(s) |
| 3-deoxy-L-threo-hex-2-ulopyranosonate (CHEBI:75552) is conjugate base of 3-deoxy-L-threo-hex-2-ulopyranosonic acid (CHEBI:75843) |
| IUPAC Name |
|---|
| 3-deoxy-L-threo-hex-2-ulopyranosonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1911400 | Reaxys |
| Citations |
|---|