EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H53N5O7S2 |
| Net Charge | 0 |
| Average Mass | 756.004 |
| Monoisotopic Mass | 755.33864 |
| SMILES | [H][C@]12OCC[C@@]1([H])[C@@H](OC(=O)N[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc3nc(NC4CCN(C5CCCC5)CC4)sc3c1)CO2 |
| InChI | InChI=1S/C38H53N5O7S2/c1-25(2)22-43(23-33(44)32(20-26-8-4-3-5-9-26)41-38(45)50-34-24-49-36-30(34)16-19-48-36)52(46,47)29-12-13-31-35(21-29)51-37(40-31)39-27-14-17-42(18-15-27)28-10-6-7-11-28/h3-5,8-9,12-13,21,25,27-28,30,32-34,36,44H,6-7,10-11,14-20,22-24H2,1-2H3,(H,39,40)(H,41,45)/t30-,32-,33+,34-,36+/m0/s1 |
| InChIKey | JQUNFHFWXCXPRK-AMMMHQJVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tmc 310911 (CHEBI:758428) has role anti-HIV agent (CHEBI:64946) |
| tmc 310911 (CHEBI:758428) is a benzenes (CHEBI:22712) |
| tmc 310911 (CHEBI:758428) is a organic amino compound (CHEBI:50047) |
| Synonym | Source |
|---|---|
| Tmc 310911 | ChEMBL |