EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25ClN6 |
| Net Charge | 0 |
| Average Mass | 360.893 |
| Monoisotopic Mass | 360.18292 |
| SMILES | Cn1ncc(-c2nc(N[C@H]3CC[C@H](N)CC3)ncc2Cl)c1CC1CC1 |
| InChI | InChI=1S/C18H25ClN6/c1-25-16(8-11-2-3-11)14(9-22-25)17-15(19)10-21-18(24-17)23-13-6-4-12(20)5-7-13/h9-13H,2-8,20H2,1H3,(H,21,23,24)/t12-,13- |
| InChIKey | RVZJFCNYSSUDCU-JOCQHMNTSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| btx-a51 (CHEBI:758427) has role antineoplastic agent (CHEBI:35610) |
| btx-a51 (CHEBI:758427) is a organohalogen compound (CHEBI:17792) |
| btx-a51 (CHEBI:758427) is a pyrimidines (CHEBI:39447) |
| Synonym | Source |
|---|---|
| Btx-a51 | ChEMBL |
| Citations |
|---|