EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H11ClF3N3O3 |
| Net Charge | 0 |
| Average Mass | 421.762 |
| Monoisotopic Mass | 421.04410 |
| SMILES | Cc1cccc(F)c1C(=O)Nc1cnc(-c2cc3c(cc2Cl)OC(F)(F)O3)cn1 |
| InChI | InChI=1S/C19H11ClF3N3O3/c1-9-3-2-4-12(21)17(9)18(27)26-16-8-24-13(7-25-16)10-5-14-15(6-11(10)20)29-19(22,23)28-14/h2-8H,1H3,(H,25,26,27) |
| InChIKey | QQMKTHUGOQDEIL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zegocractin (CHEBI:758426) has role antimicrobial agent (CHEBI:33281) |
| zegocractin (CHEBI:758426) is a carbonyl compound (CHEBI:36586) |
| zegocractin (CHEBI:758426) is a organohalogen compound (CHEBI:17792) |
| Synonyms | Source |
|---|---|
| Cm 4620 | ChEMBL |
| CM-4620 | ChEMBL |
| CM4620 | ChEMBL |
| Zegocractin | ChEMBL |
| Citations |
|---|