EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21N5O |
| Net Charge | 0 |
| Average Mass | 383.455 |
| Monoisotopic Mass | 383.17461 |
| SMILES | NC(=O)c1ccc2nc(-c3ccc(C4(N)CCC4)cc3)c(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C23H21N5O/c24-22(29)18-11-12-19-26-20(21(28(19)27-18)16-5-2-1-3-6-16)15-7-9-17(10-8-15)23(25)13-4-14-23/h1-3,5-12H,4,13-14,25H2,(H2,24,29) |
| InChIKey | JBGYKRAZYDNCNV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bay-1125976 (CHEBI:758424) has role antineoplastic agent (CHEBI:35610) |
| bay-1125976 (CHEBI:758424) is a imidazoles (CHEBI:24780) |
| Synonyms | Source |
|---|---|
| Bay 1125976 | ChEMBL |
| BAY-1125976 | ChEMBL |
| BAY1125976 | ChEMBL |
| Citations |
|---|