EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:758423 - lxe-408
| Formula | C23H18FN7O2 |
| Net Charge | 0 |
| Average Mass | 443.442 |
| Monoisotopic Mass | 443.15060 |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(F)c(-c3nc4ncc(-c5ncccc5C)cn4n3)c2)o1 |
| InChI | InChI=1S/C23H18FN7O2/c1-12-5-4-8-25-19(12)15-10-26-23-29-21(30-31(23)11-15)17-9-16(6-7-18(17)24)28-22(32)20-13(2)27-14(3)33-20/h4-11H,1-3H3,(H,28,32) |
| InChIKey | GNVVPYCWVLCWKV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lxe-408 (CHEBI:758423) has role antileishmanial agent (CHEBI:70868) |
| lxe-408 (CHEBI:758423) is a aromatic amide (CHEBI:62733) |
| Synonyms | Source |
|---|---|
| Lxe-408 | ChEMBL |
| Lxe408 | ChEMBL |
| Citations |
|---|