EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14F4N4O3S |
| Net Charge | 0 |
| Average Mass | 418.372 |
| Monoisotopic Mass | 418.07227 |
| SMILES | C[C@H](NS(=O)(=O)c1cc(C(=O)Nc2ccc(F)c(C#N)c2)n(C)c1)C(F)(F)F |
| InChI | InChI=1S/C16H14F4N4O3S/c1-9(16(18,19)20)23-28(26,27)12-6-14(24(2)8-12)15(25)22-11-3-4-13(17)10(5-11)7-21/h3-6,8-9,23H,1-2H3,(H,22,25)/t9-/m0/s1 |
| InChIKey | SBVBIDUKSBJYEF-VIFPVBQESA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bersacapavir (CHEBI:758421) has role anti-HBV agent (CHEBI:64951) |
| bersacapavir (CHEBI:758421) has role antiviral agent (CHEBI:22587) |
| bersacapavir (CHEBI:758421) is a aromatic amide (CHEBI:62733) |
| INN | Source |
|---|---|
| bersacapavir | WHO MedNet |
| Synonyms | Source |
|---|---|
| JNJ-56136379 | ChEMBL |
| JNJ-6379 | ChEMBL |
| Citations |
|---|