EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23ClN6O2 |
| Net Charge | 0 |
| Average Mass | 414.897 |
| Monoisotopic Mass | 414.15710 |
| SMILES | CONC(=O)c1ccccc1Nc1cc(Nc2cc(C)nn2C(C)C)ncc1Cl |
| InChI | InChI=1S/C20H23ClN6O2/c1-12(2)27-19(9-13(3)25-27)24-18-10-17(15(21)11-22-18)23-16-8-6-5-7-14(16)20(28)26-29-4/h5-12H,1-4H3,(H,26,28)(H2,22,23,24) |
| InChIKey | BVAHPPKGOOJSPU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-2256098 (CHEBI:758420) has role antihypertensive agent (CHEBI:35674) |
| gsk-2256098 (CHEBI:758420) has role antineoplastic agent (CHEBI:35610) |
| gsk-2256098 (CHEBI:758420) is a benzoic acids (CHEBI:22723) |
| Synonyms | Source |
|---|---|
| Gsk-2256098 | ChEMBL |
| Gsk2256098 | ChEMBL |
| Citations |
|---|