EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27F3N8O3 |
| Net Charge | 0 |
| Average Mass | 532.527 |
| Monoisotopic Mass | 532.21582 |
| SMILES | CNC(=O)c1cn(C[C@H](F)CCc2ccc(NC(=O)Cc3cc(OC4CC(F)(F)C4)cc(C)n3)nn2)nn1 |
| InChI | InChI=1S/C24H27F3N8O3/c1-14-7-18(38-19-10-24(26,27)11-19)8-17(29-14)9-22(36)30-21-6-5-16(31-33-21)4-3-15(25)12-35-13-20(32-34-35)23(37)28-2/h5-8,13,15,19H,3-4,9-12H2,1-2H3,(H,28,37)(H,30,33,36)/t15-/m1/s1 |
| InChIKey | GEHZIZWHNLQFAS-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ipn-60090 (CHEBI:758419) has role antineoplastic agent (CHEBI:35610) |
| ipn-60090 (CHEBI:758419) is a triazoles (CHEBI:35727) |
| Synonyms | Source |
|---|---|
| IACS-6274 | ChEMBL |
| Ipn 60090 | ChEMBL |
| Ipn-60090 | ChEMBL |
| IPN60090 | ChEMBL |
| Citations |
|---|