EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22N8O |
| Net Charge | 0 |
| Average Mass | 426.484 |
| Monoisotopic Mass | 426.19166 |
| SMILES | Cc1c(C#N)cccc1-c1cc(-c2cn(Cc3cccc(C(C)(C)O)n3)nn2)nc(N)n1 |
| InChI | InChI=1S/C23H22N8O/c1-14-15(11-24)6-4-8-17(14)18-10-19(28-22(25)27-18)20-13-31(30-29-20)12-16-7-5-9-21(26-16)23(2,3)32/h4-10,13,32H,12H2,1-3H3,(H2,25,27,28) |
| InChIKey | BUXIAWLTBSXYSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etrumadenant (CHEBI:758418) has role antineoplastic agent (CHEBI:35610) |
| etrumadenant (CHEBI:758418) is a benzenes (CHEBI:22712) |
| etrumadenant (CHEBI:758418) is a nitrile (CHEBI:18379) |
| INN | Source |
|---|---|
| etrumadenant | WHO MedNet |
| Synonyms | Source |
|---|---|
| AB-928 | ChEMBL |
| AB928 | ChEMBL |
| Citations |
|---|