EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24FN5O |
| Net Charge | 0 |
| Average Mass | 405.477 |
| Monoisotopic Mass | 405.19649 |
| SMILES | C[C@@H](N)COc1ccc(-c2cnc3ccc(N[C@H](C)c4cccc(F)c4)nn23)cc1 |
| InChI | InChI=1S/C23H24FN5O/c1-15(25)14-30-20-8-6-17(7-9-20)21-13-26-23-11-10-22(28-29(21)23)27-16(2)18-4-3-5-19(24)12-18/h3-13,15-16H,14,25H2,1-2H3,(H,27,28)/t15-,16-/m1/s1 |
| InChIKey | HEVHTYMYEMEBPX-HZPDHXFCSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taletrectinib (CHEBI:758413) has role antineoplastic agent (CHEBI:35610) |
| taletrectinib (CHEBI:758413) is a imidazoles (CHEBI:24780) |
| INN | Source |
|---|---|
| taletrectinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AB-106 | ChEMBL |
| DS-6051 | ChEMBL |
| DS-6051a | ChEMBL |