EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H26NO2S2 |
| Net Charge | +1 |
| Average Mass | 292.490 |
| Monoisotopic Mass | 292.13995 |
| SMILES | C[N+](C)(C)CCOC(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C13H26NO2S2/c1-14(2,3)9-10-16-13(15)7-5-4-6-12-8-11-17-18-12/h12H,4-11H2,1-3H3/q+1/t12-/m1/s1 |
| InChIKey | BJNSJJXGLIMYAJ-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arlipoic acid choline ester (CHEBI:758409) is a dithiolanes (CHEBI:39192) |
| arlipoic acid choline ester (CHEBI:758409) is a heterocyclic fatty acid (CHEBI:48847) |
| arlipoic acid choline ester (CHEBI:758409) is a thia fatty acid (CHEBI:59643) |
| Synonym | Source |
|---|---|
| Arlipoic acid choline ester | ChEMBL |