EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O6 |
| Net Charge | 0 |
| Average Mass | 178.140 |
| Monoisotopic Mass | 178.04774 |
| SMILES | O=C(O)C(=O)C[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[AOd21h]/1/ |
| InChI | InChI=1S/C6H10O6/c7-2-5(10)3(8)1-4(9)6(11)12/h3,5,7-8,10H,1-2H2,(H,11,12)/t3-,5-/m0/s1 |
| InChIKey | WPAMZTWLKIDIOP-UCORVYFPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-keto-3-deoxy-L-galactonic acid (CHEBI:75840) is a hexonic acid (CHEBI:33752) |
| 2-keto-3-deoxy-L-galactonic acid (CHEBI:75840) is a ketoaldonic acid (CHEBI:24963) |
| 2-keto-3-deoxy-L-galactonic acid (CHEBI:75840) is conjugate acid of 2-keto-3-deoxy-L-galactonate (CHEBI:75545) |
| 2-keto-3-deoxy-L-galactonic acid (CHEBI:75840) is enantiomer of 2-dehydro-3-deoxy-D-galactonic acid (CHEBI:17028) |
| Incoming Relation(s) |
| 2-keto-3-deoxy-L-galactonate (CHEBI:75545) is conjugate base of 2-keto-3-deoxy-L-galactonic acid (CHEBI:75840) |
| 2-dehydro-3-deoxy-D-galactonic acid (CHEBI:17028) is enantiomer of 2-keto-3-deoxy-L-galactonic acid (CHEBI:75840) |
| IUPAC Name |
|---|
| 3-deoxy-L-threo-hex-2-ulosonic acid |
| Synonyms | Source |
|---|---|
| 2-dehydro-3-deoxy-L-galactonic acid | ChEBI |
| L-threo-3-deoxyhexulosonic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12349 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7368614 | Reaxys |
| Citations |
|---|