EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24ClN7OS |
| Net Charge | 0 |
| Average Mass | 421.958 |
| Monoisotopic Mass | 421.14516 |
| SMILES | C[C@@H]1OCC2(CCN(c3cnc(Sc4ccnc(N)c4Cl)c(N)n3)CC2)[C@@H]1N |
| InChI | InChI=1S/C18H24ClN7OS/c1-10-14(20)18(9-27-10)3-6-26(7-4-18)12-8-24-17(16(22)25-12)28-11-2-5-23-15(21)13(11)19/h2,5,8,10,14H,3-4,6-7,9,20H2,1H3,(H2,21,23)(H2,22,25)/t10-,14+/m0/s1 |
| InChIKey | UCJZOKGUEJUNIO-IINYFYTJSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| batoprotafib (CHEBI:758398) has role antineoplastic agent (CHEBI:35610) |
| batoprotafib (CHEBI:758398) has role renoprotective agent (CHEBI:231911) |
| batoprotafib (CHEBI:758398) is a aryl sulfide (CHEBI:35683) |
| INN | Source |
|---|---|
| batoprotafib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ptpn11 inhibitor tno155 | ChEMBL |
| Shp2 inhibitor tno155 | ChEMBL |
| Tno 155 | ChEMBL |
| TNO-155 | ChEMBL |
| TNO155 | ChEMBL |
| Citations |
|---|