EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6DNO3 |
| Net Charge | 0 |
| Average Mass | 106.099 |
| Monoisotopic Mass | 106.04887 |
| SMILES | [2H][C@@](N)(CO)C(=O)O |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m1/s1/i2D |
| InChIKey | MTCFGRXMJLQNBG-LIIDHCAMSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deutarserine (CHEBI:758346) has role antipsychotic agent (CHEBI:35476) |
| deutarserine (CHEBI:758346) is a serine derivative (CHEBI:26649) |
| INN | Source |
|---|---|
| deutarserine | WHO MedNet |
| Synonyms | Source |
|---|---|
| C-21692 | ChEMBL |
| CTP-692 | ChEMBL |