EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15F3N8 |
| Net Charge | 0 |
| Average Mass | 424.390 |
| Monoisotopic Mass | 424.13718 |
| SMILES | Cn1cc2cc(C(F)(F)c3nnc4ccc(-c5cnn(C6CC6)c5)nn34)c(F)cc2n1 |
| InChI | InChI=1S/C20H15F3N8/c1-29-9-11-6-14(15(21)7-17(11)27-29)20(22,23)19-26-25-18-5-4-16(28-31(18)19)12-8-24-30(10-12)13-2-3-13/h4-10,13H,2-3H2,1H3 |
| InChIKey | QHXLXUIZUCJRKV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vebreltinib (CHEBI:758329) has role antineoplastic agent (CHEBI:35610) |
| vebreltinib (CHEBI:758329) is a triazolopyridazine (CHEBI:48384) |
| INN | Source |
|---|---|
| vebreltinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| APL-101 | ChEMBL |
| Bozitinib | ChEMBL |
| CBI-3103 | ChEMBL |
| CBT-101 | ChEMBL |
| PLB-1001 | ChEMBL |