EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N5O5 |
| Net Charge | 0 |
| Average Mass | 441.488 |
| Monoisotopic Mass | 441.20122 |
| SMILES | CC(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)OC(C)C |
| InChI | InChI=1S/C22H27N5O5/c1-13(2)32-22(31)19(9-8-16(29)12-25-23)27-21(30)20(26-14(3)28)10-15-11-24-18-7-5-4-6-17(15)18/h4-7,11-13,19-20,24H,8-10H2,1-3H3,(H,26,28)(H,27,30)/t19-,20-/m0/s1 |
| InChIKey | LQNMCWOJACNQQM-PMACEKPBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sirpiglenastat (CHEBI:758261) has role antineoplastic agent (CHEBI:35610) |
| sirpiglenastat (CHEBI:758261) is a peptide (CHEBI:16670) |
| INN | Source |
|---|---|
| sirpiglenastat | WHO MedNet |
| Synonyms | Source |
|---|---|
| DRP-104 | ChEMBL |
| (-)-sirpiglenastat | ChEMBL |
| Citations |
|---|