EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21NO4S |
| Net Charge | 0 |
| Average Mass | 383.469 |
| Monoisotopic Mass | 383.11913 |
| SMILES | Cn1cc(-c2cc(S(C)(=O)=O)ccc2OCC2CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H21NO4S/c1-22-12-19(16-5-3-4-6-17(16)21(22)23)18-11-15(27(2,24)25)9-10-20(18)26-13-14-7-8-14/h3-6,9-12,14H,7-8,13H2,1-2H3 |
| InChIKey | UWZAJPITKGWMFJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trotabresib (CHEBI:758260) has role antineoplastic agent (CHEBI:35610) |
| trotabresib (CHEBI:758260) is a isoquinolines (CHEBI:24922) |
| INN | Source |
|---|---|
| trotabresib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bet inhibitor cc-90010 | ChEMBL |
| Cc 90010 | ChEMBL |
| CC-90010 | ChEMBL |
| CC90010 | ChEMBL |
| QC-5487 | ChEMBL |
| QC5487 | ChEMBL |