EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H37F3N6O3 |
| Net Charge | 0 |
| Average Mass | 682.747 |
| Monoisotopic Mass | 682.28792 |
| SMILES | Cc1cc(N2CCN(c3ccc(C(=O)Nc4ccc(F)cc4)cc3)CC2)ccc1OC[C@@H]1CO[C@@](Cn2cncn2)(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C38H37F3N6O3/c1-26-18-33(46-16-14-45(15-17-46)32-9-2-28(3-10-32)37(48)44-31-7-4-29(39)5-8-31)11-13-36(26)49-21-27-20-38(50-22-27,23-47-25-42-24-43-47)34-12-6-30(40)19-35(34)41/h2-13,18-19,24-25,27H,14-17,20-23H2,1H3,(H,44,48)/t27-,38+/m1/s1 |
| InChIKey | OSAMZQJKSCAOHA-CWRQMEKBSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| opelconazole (CHEBI:758257) has role antifungal agent (CHEBI:35718) |
| opelconazole (CHEBI:758257) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| Opelconazole | ChEMBL |
| Opelconazole(inn) | ChEMBL |
| PC-945 | ChEMBL |
| PC945 | ChEMBL |