EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23F2N5O2.C6H6O3S |
| Net Charge | 0 |
| Average Mass | 609.655 |
| Monoisotopic Mass | 609.18575 |
| SMILES | COc1ccc(-c2c(-c3ccc(C#N)c(F)c3)nc(N3CCC(N)CC3)n(C)c2=O)cc1F.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C24H23F2N5O2.C6H6O3S/c1-30-23(32)21(14-5-6-20(33-2)19(26)11-14)22(15-3-4-16(13-27)18(25)12-15)29-24(30)31-9-7-17(28)8-10-31;7-10(8,9)6-4-2-1-3-5-6/h3-6,11-12,17H,7-10,28H2,1-2H3;1-5H,(H,7,8,9) |
| InChIKey | AWZCBGWZNHQCIZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pulrodemstat besilate (CHEBI:758255) has role antineoplastic agent (CHEBI:35610) |
| pulrodemstat besilate (CHEBI:758255) is a organosulfur compound (CHEBI:33261) |
| pulrodemstat besilate (CHEBI:758255) is a sulfonic acid derivative (CHEBI:33552) |
| Synonyms | Source |
|---|---|
| Cc 90011 | ChEMBL |
| CC-90011 | ChEMBL |
| CC90011 | ChEMBL |
| Pulrodemstat benzenesulfonate | ChEMBL |
| Pulrodemstat besilate | ChEMBL |
| Citations |
|---|