EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:758253 - isuzinaxib hydrochloride
| Formula | HCl.C17H17N3O |
| Net Charge | 0 |
| Average Mass | 315.804 |
| Monoisotopic Mass | 315.11384 |
| SMILES | CCCc1c(-c2ccccc2)nn(-c2ccccn2)c1O.Cl |
| InChI | InChI=1S/C17H17N3O.ClH/c1-2-8-14-16(13-9-4-3-5-10-13)19-20(17(14)21)15-11-6-7-12-18-15;/h3-7,9-12,21H,2,8H2,1H3;1H |
| InChIKey | GMFJXGGAGPCRBM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isuzinaxib hydrochloride (CHEBI:758253) has role antiviral agent (CHEBI:22587) |
| isuzinaxib hydrochloride (CHEBI:758253) has role renoprotective agent (CHEBI:231911) |
| isuzinaxib hydrochloride (CHEBI:758253) is a pyrazolopyridine (CHEBI:46699) |
| Synonyms | Source |
|---|---|
| Apx 115 | ChEMBL |
| APX-115 | ChEMBL |
| APX115 | ChEMBL |
| EWHA-18278 | ChEMBL |
| Isuzinaxib hydrochloride | ChEMBL |