EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N3 |
| Net Charge | 0 |
| Average Mass | 166.190 |
| Monoisotopic Mass | 166.08841 |
| SMILES | N=C(N)NCc1cccc([18F])c1 |
| InChI | InChI=1S/C8H10FN3/c9-7-3-1-2-6(4-7)5-12-8(10)11/h1-4H,5H2,(H4,10,11,12)/i9-1 |
| InChIKey | HNPHEZIYSZIWHH-RVRFMXCPSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. diagnostic imaging agent A substance administered to enhance contrast in images of the inside of the body obtained using X-rays, γ-rays, sound waves, radio waves (MRI), or radioactive particles in order to diagnose disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| florbenguane f18 (CHEBI:758249) has role antineoplastic agent (CHEBI:35610) |
| florbenguane f18 (CHEBI:758249) has role cardiovascular drug (CHEBI:35554) |
| florbenguane f18 (CHEBI:758249) has role diagnostic imaging agent (CHEBI:37334) |
| florbenguane f18 (CHEBI:758249) is a organofluorine compound (CHEBI:37143) |
| INNs | Source |
|---|---|
| florbenguane (18f) | WHO MedNet |
| florbenguane f18 | WHO MedNet |
| florbenguano (18f) | WHO MedNet |
| Synonyms | Source |
|---|---|
| 18f-mfbg | ChEMBL |
| Florbenguane f-18 | ChEMBL |
| IRP 101 | ChEMBL |
| IRP-101 | ChEMBL |
| M-(18f)-fluorobenzylguanidine | ChEMBL |
| Mfbg f-18 | ChEMBL |