EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C12H14ClNO2 |
| Net Charge | 0 |
| Average Mass | 276.163 |
| Monoisotopic Mass | 275.04798 |
| SMILES | Cl.N[C@@]1(c2ccccc2Cl)CCC[C@@H](O)C1=O |
| InChI | InChI=1S/C12H14ClNO2.ClH/c13-9-5-2-1-4-8(9)12(14)7-3-6-10(15)11(12)16;/h1-2,4-5,10,15H,3,6-7,14H2;1H/t10-,12-;/m1./s1 |
| InChIKey | ZQJVHBJDLMIKJK-MHDYBILJSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxynorketamine, (2r,6r)-, hydrochloride (CHEBI:758248) has role antidepressant (CHEBI:35469) |
| hydroxynorketamine, (2r,6r)-, hydrochloride (CHEBI:758248) is a organochlorine compound (CHEBI:36683) |
| Synonyms | Source |
|---|---|
| (2r,6r)-hnk hydrochloride | ChEMBL |
| (2r,6r)-hydroxynorketamine hydrochloride | ChEMBL |
| Hydroxynorketamine, (2r,6r)-, hydrochloride | ChEMBL |