EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H22F2N4O3 |
| Net Charge | 0 |
| Average Mass | 488.494 |
| Monoisotopic Mass | 488.16600 |
| SMILES | O=C(c1ccc(F)cc1)N1CCN(C(=O)c2cc(Cc3nnc(=O)c4ccccc34)ccc2F)CC1 |
| InChI | InChI=1S/C27H22F2N4O3/c28-19-8-6-18(7-9-19)26(35)32-11-13-33(14-12-32)27(36)22-15-17(5-10-23(22)29)16-24-20-3-1-2-4-21(20)25(34)31-30-24/h1-10,15H,11-14,16H2,(H,31,34) |
| InChIKey | LTZZZXXIKHHTMO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| parpi (CHEBI:758246) has role antineoplastic agent (CHEBI:35610) |
| parpi (CHEBI:758246) is a phthalazines (CHEBI:38768) |
| Synonym | Source |
|---|---|
| Parpi | ChEMBL |