EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H39N3O4 |
| Net Charge | 0 |
| Average Mass | 517.670 |
| Monoisotopic Mass | 517.29406 |
| SMILES | O=C(O)c1cccc(CN2CN(C3CCCCC3)C3(CCN(CCCC(=O)c4ccccc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C31H39N3O4/c35-28(25-10-3-1-4-11-25)15-8-18-32-19-16-31(17-20-32)30(38)33(23-34(31)27-13-5-2-6-14-27)22-24-9-7-12-26(21-24)29(36)37/h1,3-4,7,9-12,21,27H,2,5-6,8,13-20,22-23H2,(H,36,37) |
| InChIKey | BDXJYAAYLZTLEK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trazpiroben (CHEBI:758237) has role gastrointestinal drug (CHEBI:55324) |
| trazpiroben (CHEBI:758237) is a aromatic ketone (CHEBI:76224) |
| INN | Source |
|---|---|
| trazpiroben | WHO MedNet |
| Synonyms | Source |
|---|---|
| TAK-906 | ChEMBL |
| TAK906 | ChEMBL |