EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H21F2N5O3 |
| Net Charge | 0 |
| Average Mass | 489.482 |
| Monoisotopic Mass | 489.16125 |
| SMILES | CC#CC(=O)N1CC[C@@H](n2cc(-c3ccc(Oc4c(F)cccc4F)cc3)c3c(N)nnc(=O)c32)C1 |
| InChI | InChI=1S/C26H21F2N5O3/c1-2-4-21(34)32-12-11-16(13-32)33-14-18(22-23(33)26(35)31-30-25(22)29)15-7-9-17(10-8-15)36-24-19(27)5-3-6-20(24)28/h3,5-10,14,16H,11-13H2,1H3,(H2,29,30)(H,31,35)/t16-/m1/s1 |
| InChIKey | DNPOFZXZJJDQLB-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edralbrutinib (CHEBI:758235) has role antineoplastic agent (CHEBI:35610) |
| edralbrutinib (CHEBI:758235) has role renoprotective agent (CHEBI:231911) |
| edralbrutinib (CHEBI:758235) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| edralbrutinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| SHR-1459 | ChEMBL |
| SHR1459 | ChEMBL |
| Tg 1701 | ChEMBL |
| TG-1701 | ChEMBL |
| TG1701 | ChEMBL |