EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H27N5O3 |
| Net Charge | 0 |
| Average Mass | 469.545 |
| Monoisotopic Mass | 469.21139 |
| SMILES | COc1ccc(-c2cncc(N[C@@H](C)c3cccc(NC(=O)c4cncc(C)c4)c3)n2)cc1OC |
| InChI | InChI=1S/C27H27N5O3/c1-17-10-21(14-28-13-17)27(33)31-22-7-5-6-19(11-22)18(2)30-26-16-29-15-23(32-26)20-8-9-24(34-3)25(12-20)35-4/h5-16,18H,1-4H3,(H,30,32)(H,31,33)/t18-/m0/s1 |
| InChIKey | JHJNPOSPVGRIAN-SFHVURJKSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| seralutinib (CHEBI:758231) has role antihypertensive agent (CHEBI:35674) |
| seralutinib (CHEBI:758231) is a aromatic amide (CHEBI:62733) |
| INN | Source |
|---|---|
| seralutinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| GB-002 | ChEMBL |
| GB002 | ChEMBL |
| PK-10571 | ChEMBL |