EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23N3O6S |
| Net Charge | 0 |
| Average Mass | 457.508 |
| Monoisotopic Mass | 457.13076 |
| SMILES | O=C([C@H](CO)c1ccccc1)N1CC2=C(C1)CN(S(=O)(=O)c1cnc3c(c1)OCCO3)C2 |
| InChI | InChI=1S/C22H23N3O6S/c26-14-19(15-4-2-1-3-5-15)22(27)24-10-16-12-25(13-17(16)11-24)32(28,29)18-8-20-21(23-9-18)31-7-6-30-20/h1-5,8-9,19,26H,6-7,10-14H2/t19-/m1/s1 |
| InChIKey | KZFFYEPYCVDOGE-LJQANCHMSA-N |
| Roles Classification |
|---|
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etavopivat (CHEBI:758230) has role anti-anaemic agent (CHEBI:75835) |
| etavopivat (CHEBI:758230) has role antineoplastic agent (CHEBI:35610) |
| etavopivat (CHEBI:758230) is a pyridines (CHEBI:26421) |
| etavopivat (CHEBI:758230) is a sulfonamide (CHEBI:35358) |
| INN | Source |
|---|---|
| etavopivat | WHO MedNet |
| Synonym | Source |
|---|---|
| FT-4202 | ChEMBL |