EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26F2N8O4S2 |
| Net Charge | 0 |
| Average Mass | 604.665 |
| Monoisotopic Mass | 604.14865 |
| SMILES | C[S@+]([O-])CCOc1cc(N2CCN(CCn3c(=O)sc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)c(F)cc1F |
| InChI | InChI=1S/C25H26F2N8O4S2/c1-41(37)12-11-39-19-14-17(15(26)13-16(19)27)33-7-4-32(5-8-33)6-9-34-22-20(40-25(34)36)23-29-21(18-3-2-10-38-18)31-35(23)24(28)30-22/h2-3,10,13-14H,4-9,11-12H2,1H3,(H2,28,30)/t41-/m0/s1 |
| InChIKey | QYCCLUSYHJXDEX-RWYGWLOXSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inupadenant (CHEBI:758229) has role antineoplastic agent (CHEBI:35610) |
| inupadenant (CHEBI:758229) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| inupadenant | WHO MedNet |
| Synonyms | Source |
|---|---|
| EOS-100850 | ChEMBL |
| EOS100850 | ChEMBL |