EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11N7O |
| Net Charge | 0 |
| Average Mass | 281.279 |
| Monoisotopic Mass | 281.10251 |
| SMILES | Nc1nccc(-c2ccc(O)c(-c3ccnc(N)n3)n2)n1 |
| InChI | InChI=1S/C13H11N7O/c14-12-16-5-3-8(19-12)7-1-2-10(21)11(18-7)9-4-6-17-13(15)20-9/h1-6,21H,(H2,14,16,19)(H2,15,17,20) |
| InChIKey | VFVAQKKPFOPZEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avotaciclib (CHEBI:758226) has role antineoplastic agent (CHEBI:35610) |
| avotaciclib (CHEBI:758226) is a chloropyridine (CHEBI:39173) |
| INN | Source |
|---|---|
| avotaciclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BEY-1107 | ChEMBL |
| BEY1107 | ChEMBL |
| Cdk1 inhibitor bey1107 | ChEMBL |
| Citations |
|---|