EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:758224 - terevalefim
| Formula | C9H8N2S |
| Net Charge | 0 |
| Average Mass | 176.244 |
| Monoisotopic Mass | 176.04082 |
| SMILES | C(=C/c1cccs1)\c1ccnn1 |
| InChI | InChI=1S/C9H8N2S/c1-2-9(12-7-1)4-3-8-5-6-10-11-8/h1-7H,(H,10,11)/b4-3+ |
| InChIKey | FOHWAQGURRYJFK-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terevalefim (CHEBI:758224) has role renoprotective agent (CHEBI:231911) |
| terevalefim (CHEBI:758224) is a pyrazoles (CHEBI:26410) |
| INN | Source |
|---|---|
| terevalefim | WHO MedNet |
| Synonyms | Source |
|---|---|
| ANG-3777 | ChEMBL |
| BB-3 | ChEMBL |
| BB3 | ChEMBL |
| Refanalin | ChEMBL |
| SNV-003 | ChEMBL |