EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H28BrN7O3 |
| Net Charge | 0 |
| Average Mass | 602.493 |
| Monoisotopic Mass | 601.14370 |
| SMILES | [H][C@@]12C[C@]1(C)C[C@@H](C(=O)Nc1nc(Br)ccc1C)N2C(=O)Cn1nc(C(C)=O)c2cc(-c3cnc(C)nc3)ccc21 |
| InChI | InChI=1S/C29H28BrN7O3/c1-15-5-8-24(30)33-27(15)34-28(40)22-10-29(4)11-23(29)37(22)25(39)14-36-21-7-6-18(19-12-31-17(3)32-13-19)9-20(21)26(35-36)16(2)38/h5-9,12-13,22-23H,10-11,14H2,1-4H3,(H,33,34,40)/t22-,23+,29-/m0/s1 |
| InChIKey | OCXAGXCMZACNEC-CTWZREHQSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vemircopan (CHEBI:758223) has role anti-inflammatory agent (CHEBI:67079) |
| vemircopan (CHEBI:758223) has role renoprotective agent (CHEBI:231911) |
| vemircopan (CHEBI:758223) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| vemircopan | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACH-0145228 | ChEMBL |
| ACH-5228 | ChEMBL |
| ALXN-2050 | ChEMBL |
| ALXN2050 | ChEMBL |