EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H12F3N3O4S2 |
| Net Charge | 0 |
| Average Mass | 467.450 |
| Monoisotopic Mass | 467.02213 |
| SMILES | O=C(NCc1cnc(C(F)(F)F)s1)c1ccc2c(c1)NC(=O)c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C19H12F3N3O4S2/c20-19(21,22)18-24-9-11(30-18)8-23-16(26)10-5-6-15-13(7-10)25-17(27)12-3-1-2-4-14(12)31(15,28)29/h1-7,9H,8H2,(H,23,26)(H,25,27) |
| InChIKey | LBJVBJYMZKEREY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vebicorvir (CHEBI:758222) has role anti-HBV agent (CHEBI:64951) |
| vebicorvir (CHEBI:758222) is a dibenzothiazepine (CHEBI:39268) |
| INN | Source |
|---|---|
| vebicorvir | WHO MedNet |
| Synonym | Source |
|---|---|
| ABI-H0731 | ChEMBL |
| Citations |
|---|