EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H39N7O4 |
| Net Charge | 0 |
| Average Mass | 585.709 |
| Monoisotopic Mass | 585.30635 |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(C(=O)OC(C)C)c(-c3cn(C)c4ccccc34)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C32H39N7O4/c1-9-29(40)34-24-16-25(28(42-8)17-27(24)38(6)15-14-37(4)5)35-32-33-18-22(31(41)43-20(2)3)30(36-32)23-19-39(7)26-13-11-10-12-21(23)26/h9-13,16-20H,1,14-15H2,2-8H3,(H,34,40)(H,33,35,36) |
| InChIKey | AZSRSNUQCUDCGG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mobocertinib (CHEBI:758219) has role antineoplastic agent (CHEBI:35610) |
| mobocertinib (CHEBI:758219) has role renoprotective agent (CHEBI:231911) |
| mobocertinib (CHEBI:758219) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| AP-32788 | ChEMBL |
| AP32788 | ChEMBL |
| Mobocertinib | ChEMBL |
| TAK-788 | ChEMBL |
| Citations |
|---|