EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13F6N3O3 |
| Net Charge | 0 |
| Average Mass | 361.242 |
| Monoisotopic Mass | 361.08611 |
| SMILES | COc1nc(C(=O)NC[C@](C)(O)C(F)(F)F)c(N)cc1C(F)(F)F |
| InChI | InChI=1S/C12H13F6N3O3/c1-10(23,12(16,17)18)4-20-8(22)7-6(19)3-5(11(13,14)15)9(21-7)24-2/h3,23H,4,19H2,1-2H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | USHQRIKZLHNPQR-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icenticaftor (CHEBI:758218) is a aromatic carboxylic acid (CHEBI:33859) |
| icenticaftor (CHEBI:758218) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| INN | Source |
|---|---|
| icenticaftor | WHO MedNet |
| Synonyms | Source |
|---|---|
| QBW-251 | ChEMBL |
| QBW251 | ChEMBL |
| Citations |
|---|