EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23IN6O2S |
| Net Charge | 0 |
| Average Mass | 526.404 |
| Monoisotopic Mass | 526.06479 |
| SMILES | CC(C)(C)CNCCn1c(Sc2cc3c(cc2I)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C19H23IN6O2S/c1-19(2,3)8-22-4-5-26-17-15(16(21)23-9-24-17)25-18(26)29-14-7-13-12(6-11(14)20)27-10-28-13/h6-7,9,22H,4-5,8,10H2,1-3H3,(H2,21,23,24) |
| InChIKey | UYODNJZBUUEXPC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icapamespib (CHEBI:758217) has role antineoplastic agent (CHEBI:35610) |
| icapamespib (CHEBI:758217) is a aryl sulfide (CHEBI:35683) |
| INN | Source |
|---|---|
| icapamespib | WHO MedNet |
| Synonym | Source |
|---|---|
| PU-HZ151 | ChEMBL |
| Citations |
|---|